Azido-PEG7-azide structure
|
Common Name | Azido-PEG7-azide | ||
|---|---|---|---|---|
| CAS Number | 225523-86-4 | Molecular Weight | 420.461 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H32N6O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Azido-PEG7-azideAzido-PEG7-azide is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | 1,23-Diazido-3,6,9,12,15,18,21-heptaoxatricosane |
|---|---|
| Synonym | More Synonyms |
| Description | Azido-PEG7-azide is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Molecular Formula | C16H32N6O7 |
|---|---|
| Molecular Weight | 420.461 |
| Exact Mass | 420.233246 |
| LogP | -1.66 |
| InChIKey | NVKODTBPHMGJLW-UHFFFAOYSA-N |
| SMILES | [N-]=[N+]=NCCOCCOCCOCCOCCOCCOCCOCCN=[N+]=[N-] |
| 3,6,9,12,15,18,21-Heptaoxatricosane, 1,23-diazido- |
| 1,23-Diazido-3,6,9,12,15,18,21-heptaoxatricosane |