Piperidinylaminomethyl Trifluoromethyl Cyclic Ether Compound 1 structure
|
Common Name | Piperidinylaminomethyl Trifluoromethyl Cyclic Ether Compound 1 | ||
|---|---|---|---|---|
| CAS Number | 225526-17-0 | Molecular Weight | 434.49 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H29F3N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Piperidinylaminomethyl Trifluoromethyl Cyclic Ether Compound 1Piperidinylaminomethyl Trifluoromethyl Cyclic Ether Compound 1 has the potential function in central nervous system disorders, respiratory, inflammatory diseases and gastrointestinal disorders. |
| Name | Piperidinylaminomethyl Trifluoromethyl Cyclic Ether Compound 1 |
|---|
| Description | Piperidinylaminomethyl Trifluoromethyl Cyclic Ether Compound 1 has the potential function in central nervous system disorders, respiratory, inflammatory diseases and gastrointestinal disorders. |
|---|---|
| Related Catalog | |
| In Vitro | Piperidinylaminomethyl Trifluoromethyl Cyclic Ether Compound 1 has the potential function in numerous diseases, including central nervous system disorders such as depression, anxiety and schizophrenia, in respiratory and inflammatory diseases such as asthma and rheumatoid arthritis, in gastrointestinal disorders and diseases of the GI tract such as ulcerative colitis and Crohn's disease, and in the transmission of pain, including migraine[1]. |
| References |
| Molecular Formula | C24H29F3N2O2 |
|---|---|
| Molecular Weight | 434.49 |
| InChIKey | ODEBBNRINYMIRX-XWQVQCDNSA-N |
| SMILES | COc1cc2c(cc1CNC1CCCNC1c1ccccc1)C(C)(C(F)(F)F)OCC2 |