(6α)-Hopane-6,22-diol structure
|
Common Name | (6α)-Hopane-6,22-diol | ||
|---|---|---|---|---|
| CAS Number | 22570-53-2 | Molecular Weight | 444.733 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 515.6±23.0 °C at 760 mmHg | |
| Molecular Formula | C30H52O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 206.4±17.2 °C | |
Use of (6α)-Hopane-6,22-diolZeorin is a compound isolated from the lichen Parmotrema sancti-angelii[1]. |
| Name | zeorin |
|---|---|
| Synonym | More Synonyms |
| Description | Zeorin is a compound isolated from the lichen Parmotrema sancti-angelii[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 515.6±23.0 °C at 760 mmHg |
| Molecular Formula | C30H52O2 |
| Molecular Weight | 444.733 |
| Flash Point | 206.4±17.2 °C |
| Exact Mass | 444.396729 |
| PSA | 40.46000 |
| LogP | 9.10 |
| Vapour Pressure | 0.0±3.0 mmHg at 25°C |
| Index of Refraction | 1.521 |
| InChIKey | KYBLAIAGFNCVHL-PMVHANJISA-N |
| SMILES | CC(C)(O)C1CCC2(C)C1CCC1(C)C2CCC2C3(C)CCCC(C)(C)C3C(O)CC21C |
| Hazard Codes | Xi |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| zeorine |
| 1H-Cyclopenta[a]chrysene-3-methanol, eicosahydro-7-hydroxy-α,α,5a,5b,8,8,11a,13b-octamethyl-, (3S,3aS,5aR,5bR,7S,7aS,11aR,11bR,13aR,13bS)- |
| (6α)-Hopane-6,22-diol |