Ethanone,1-(2-methyl-1H-indol-3-yl)- structure
|
Common Name | Ethanone,1-(2-methyl-1H-indol-3-yl)- | ||
|---|---|---|---|---|
| CAS Number | 22582-52-1 | Molecular Weight | 173.21100 | |
| Density | 1.157g/cm3 | Boiling Point | 340.4ºC at 760mmHg | |
| Molecular Formula | C11H11NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 167.6ºC | |
| Name | 1-(2-methyl-1H-indol-3-yl)ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.157g/cm3 |
|---|---|
| Boiling Point | 340.4ºC at 760mmHg |
| Molecular Formula | C11H11NO |
| Molecular Weight | 173.21100 |
| Flash Point | 167.6ºC |
| Exact Mass | 173.08400 |
| PSA | 32.86000 |
| LogP | 2.67890 |
| Vapour Pressure | 8.64E-05mmHg at 25°C |
| Index of Refraction | 1.631 |
| InChIKey | VFPVFOXCCXHMCF-UHFFFAOYSA-N |
| SMILES | CC(=O)c1c(C)[nH]c2ccccc12 |
| HS Code | 2933990090 |
|---|
| Precursor 8 | |
|---|---|
| DownStream 6 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-methyl-3-acetyl-1H-indole |
| 1-(2-methyl-indol-3-yl)-ethanone |
| Ethanone,1-(2-methyl-1H-indol-3-yl) |
| 3-acetyl-2-methyl indole |
| 2-methyl-3-acetylindole |
| F1443-1081 |
| Methyl 2-methyl-3-indolyl ketone |