Epifriedelal acetate structure
|
Common Name | Epifriedelal acetate | ||
|---|---|---|---|---|
| CAS Number | 2259-07-6 | Molecular Weight | 470.770 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 461.9±13.0 °C at 760 mmHg | |
| Molecular Formula | C32H54O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 264.4±7.4 °C | |
Use of Epifriedelal acetateEpifriedelanol acetate (Compound Ⅲc) is a nature product. Epifriedelanol acetate can be isolated from Pachysandra terminalis Sieb[1]. |
| Name | (3S,4R,4aS,6aS,6bR,8aR,12aR,12bS,14aS,14bS)-4,4a,6b,8a,11,11,12b, 14a-Octamethyldocosahydro-3-picenyl acetate |
|---|---|
| Synonym | More Synonyms |
| Description | Epifriedelanol acetate (Compound Ⅲc) is a nature product. Epifriedelanol acetate can be isolated from Pachysandra terminalis Sieb[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 461.9±13.0 °C at 760 mmHg |
| Molecular Formula | C32H54O2 |
| Molecular Weight | 470.770 |
| Flash Point | 264.4±7.4 °C |
| Exact Mass | 470.412384 |
| PSA | 26.30000 |
| LogP | 12.34 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.521 |
| InChIKey | NXKDUDYUASKXAY-CSVRJXMTSA-N |
| SMILES | CC(=O)OC1CCC2C(C)(CCC3C2(C)CCC2(C)C4CC(C)(C)CCC4(C)CCC32C)C1C |
| (3S,4R,4aS,6aS,6bR,8aR,12aR,12bS,14aS,14bS)-4,4a,6b,8a,11,11,12b,14a-Octamethyldocosahydro-3-picenyl acetate |
| 3-Picenol, docosahydro-4,4a,6b,8a,11,11,12b,14a-octamethyl-, acetate, (3S,4R,4aS,6aS,6bR,8aR,12aR,12bS,14aS,14bS)- |