hexyl 2,2,3,3,4,4,5,5,6,6,6-undecafluorohexanoate structure
|
Common Name | hexyl 2,2,3,3,4,4,5,5,6,6,6-undecafluorohexanoate | ||
|---|---|---|---|---|
| CAS Number | 2261-09-8 | Molecular Weight | 398.21300 | |
| Density | 1.371g/cm3 | Boiling Point | 221.1ºC at 760 mmHg | |
| Molecular Formula | C12H13F11O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 85.2ºC | |
| Name | hexyl 2,2,3,3,4,4,5,5,6,6,6-undecafluorohexanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.371g/cm3 |
|---|---|
| Boiling Point | 221.1ºC at 760 mmHg |
| Molecular Formula | C12H13F11O2 |
| Molecular Weight | 398.21300 |
| Flash Point | 85.2ºC |
| Exact Mass | 398.07400 |
| PSA | 26.30000 |
| LogP | 5.21340 |
| Vapour Pressure | 0.109mmHg at 25°C |
| Index of Refraction | 1.341 |
| InChIKey | TXJKATBVTOHLTD-UHFFFAOYSA-N |
| SMILES | CCCCCCOC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| HS Code | 2915900090 |
|---|
| HS Code | 2915900090 |
|---|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
| Perfluorhexansaeure-hexylester |
| Undecafluor-capronsaeure-hexylester |
| 2,2,3,3,4,4,5,5,6,6,6-Undecafluoro-hexanoic acid hexyl ester |
| Hexanoic acid,undecafluoro-,hexyl ester |