Perfluorohexanesulfonic acid structure
|
Common Name | Perfluorohexanesulfonic acid | ||
|---|---|---|---|---|
| CAS Number | 355-46-4 | Molecular Weight | 400.11500 | |
| Density | 1.841g/cm3 | Boiling Point | 238.5℃ | |
| Molecular Formula | C6HF13O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,1,2,2,3,3,4,4,5,5,6,6,6-Tridecafluorohexane-1-sulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.841g/cm3 |
|---|---|
| Boiling Point | 238.5℃ |
| Molecular Formula | C6HF13O3S |
| Molecular Weight | 400.11500 |
| Exact Mass | 399.94400 |
| PSA | 62.75000 |
| LogP | 4.65130 |
| Index of Refraction | 1.309 |
| InChIKey | QZHDEAJFRJCDMF-UHFFFAOYSA-N |
| SMILES | O=S(=O)(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| Hazard Codes | C |
|---|---|
| RIDADR | 3261.0 |
| Hazard Class | 8.0 |
| HS Code | 2904909090 |
|
~%
Perfluorohexane... CAS#:355-46-4 |
| Literature: Gmelin Handbook: F: PerFHalOrg.SVol.3, 6.2.3.1, page 48 - 120 |
|
~%
Perfluorohexane... CAS#:355-46-4 |
| Literature: Gmelin Handbook: F: PerFHalOrg.SVol.3, 6.2.3.1, page 48 - 120 |
|
~%
Perfluorohexane... CAS#:355-46-4 |
| Literature: Gmelin Handbook: F: PerFHalOrg.SVol.3, 6.2.3.1, page 48 - 120 |
|
~%
Perfluorohexane... CAS#:355-46-4 |
| Literature: Gmelin Handbook: F: PerFHalOrg.SVol.3, 6.2.3.1, page 48 - 120 |
|
~%
Perfluorohexane... CAS#:355-46-4 |
| Literature: Gmelin Handbook: F: PerFHalOrg.2, 1.3.1, page 76 - 99 |
|
~%
Perfluorohexane... CAS#:355-46-4 |
| Literature: Gmelin Handbook: F: PerFHalOrg.SVol.3, 6.2.3.1, page 48 - 120 |
|
~%
Perfluorohexane... CAS#:355-46-4 |
| Literature: Haszeldine,R.N. et al. Journal of the Chemical Society, Chemical Communications, 1972 , p. 249 - 250 |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| EINECS 206-587-1 |
| Tridecafluorohexanesulfonic acid |
| Perfluorohexanesulfonic acid |
| Tridecafluor-hexan-1-sulfonsaeure |
| perflourohexanesulfonic acid |
| tridecafluoro-hexane-1-sulfonic acid |
| perfluorohexane-1-sulfonic acid |
| Perfluorohexane-1-sulphonic acid |
| perfluorohexanesulfonate |