1H,1H,5H-Octafluoropentyl p-toluenesulfonate structure
|
Common Name | 1H,1H,5H-Octafluoropentyl p-toluenesulfonate | ||
|---|---|---|---|---|
| CAS Number | 2264-00-8 | Molecular Weight | 386.25800 | |
| Density | 1.5127 | Boiling Point | 157/5mm | |
| Molecular Formula | C12H10F8O3S | Melting Point | 8-12ºC | |
| MSDS | N/A | Flash Point | >110 | |
| Name | 1H,1H,5H-Octafluoropentyl p-toluenesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5127 |
|---|---|
| Boiling Point | 157/5mm |
| Melting Point | 8-12ºC |
| Molecular Formula | C12H10F8O3S |
| Molecular Weight | 386.25800 |
| Flash Point | >110 |
| Exact Mass | 386.02200 |
| PSA | 51.75000 |
| LogP | 4.95210 |
| Vapour Pressure | 7.67E-05mmHg at 25°C |
| Index of Refraction | 1.4325 |
| InChIKey | ACPMGBQCNGPAAY-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)OCC(F)(F)C(F)(F)C(F)(F)C(F)F)cc1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2905590090 |
|
~83%
1H,1H,5H-Octafl... CAS#:2264-00-8 |
| Literature: Shilin, S. V.; Florensova, O. N.; Chernov, N. F.; Voronkov, M. G. J. Gen. Chem. USSR (Engl. Transl.), 1991 , vol. 61, # 8.2 p. 1838 - 1840,1697 - 1699 |
| Precursor 2 | |
|---|---|
| DownStream 8 | |
| HS Code | 2905590090 |
|---|---|
| Summary | 2905590090 other halogenated, sulphonated, nitrated or nitrosated derivatives of acyclic alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 2,2,3,3,4,4,5,5-octafluoropentyl 4-methylbenzenesulfonate |