torachrysone structure
|
Common Name | torachrysone | ||
|---|---|---|---|---|
| CAS Number | 22649-04-3 | Molecular Weight | 246.259 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 457.1±40.0 °C at 760 mmHg | |
| Molecular Formula | C14H14O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 176.3±20.8 °C | |
Use of torachrysoneTorachrysone (Nakahalene; Trachrysone), a naphthalene, can be isolated from Cassia tora L[1]. |
| Name | 1-(1,8-Dihydroxy-6-methoxy-3-methyl-2-naphthyl)ethanone |
|---|---|
| Synonym | More Synonyms |
| Description | Torachrysone (Nakahalene; Trachrysone), a naphthalene, can be isolated from Cassia tora L[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 457.1±40.0 °C at 760 mmHg |
| Molecular Formula | C14H14O4 |
| Molecular Weight | 246.259 |
| Flash Point | 176.3±20.8 °C |
| Exact Mass | 246.089203 |
| PSA | 66.76000 |
| LogP | 2.70 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.642 |
| InChIKey | BIJOPUWEMBBDEG-UHFFFAOYSA-N |
| SMILES | COc1cc(O)c2c(O)c(C(C)=O)c(C)cc2c1 |
| Storage condition | 2-8℃ |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2914509090 |
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 1,4-Naphthalenedione,2-acetyl |
| 2-acetyl-1,8-dihydroxy-3-methyl-6-methoxynaphthalene |
| 2-acetylnaphthoquinone |
| Torachryson |
| 1,4-Naphthoquinone,2-acetyl |
| Torachrysone |
| 1.4.21-Trioxo-2-aethyl-naphthalin-dihydrid |
| 1-(1,8-Dihydroxy-6-methoxy-3-methyl-2-naphthyl)ethanone |
| Ethanone, 1-(1,8-dihydroxy-6-methoxy-3-methyl-2-naphthalenyl)- |
| 2-Acetyl-6-methoxy-3-methyl-1.8-naphthalindiol |
| 2-Acetyl-1,4-naphthoquinone |