2-Nitro-4-(trifluoromethoxy)aniline structure
|
Common Name | 2-Nitro-4-(trifluoromethoxy)aniline | ||
|---|---|---|---|---|
| CAS Number | 2267-23-4 | Molecular Weight | 222.121 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 284.3±35.0 °C at 760 mmHg | |
| Molecular Formula | C7H5F3N2O3 | Melting Point | 62 °C | |
| MSDS | N/A | Flash Point | 125.7±25.9 °C | |
| Name | 2-Nitro-4-(trifluoromethoxy)aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 284.3±35.0 °C at 760 mmHg |
| Melting Point | 62 °C |
| Molecular Formula | C7H5F3N2O3 |
| Molecular Weight | 222.121 |
| Flash Point | 125.7±25.9 °C |
| Exact Mass | 222.025223 |
| PSA | 81.07000 |
| LogP | 2.98 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.526 |
| InChIKey | YCGFVAPIBALHRT-UHFFFAOYSA-N |
| SMILES | Nc1ccc(OC(F)(F)F)cc1[N+](=O)[O-] |
| Hazard Codes | Xn:Harmful; |
|---|---|
| Risk Phrases | R20/21/22;R36/37/38 |
| Safety Phrases | S23-S36/37/39-S26 |
| HS Code | 2922299090 |
|
~%
2-Nitro-4-(trif... CAS#:2267-23-4 |
| Literature: Journal of Medicinal Chemistry, , vol. 38, # 10 p. 1786 - 1792 |
|
~95%
2-Nitro-4-(trif... CAS#:2267-23-4 |
| Literature: Maligres, Peter E.; Humphrey, Guy R.; Marcoux, Jean-Francois; Hillier, Michael C.; Zhao, Dalian; Krska, Shane; Grabowski, Edward J.J. Organic Process Research and Development, 2009 , vol. 13, # 3 p. 525 - 534 |
|
~%
2-Nitro-4-(trif... CAS#:2267-23-4 |
| Literature: Journal of Medicinal Chemistry, , vol. 38, # 10 p. 1786 - 1792 |
| Precursor 3 | |
|---|---|
| DownStream 6 | |
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-nitro-4-trifluoromethoxy-phenylamine |
| 1-Amino-2-nitro-4-(trifluoromethoxy)benzene |
| 2-nitro-4-trifluoromethoxy-aniline |
| 4-Trifluoromethoxy-2-nitroaniline |
| MFCD00042326 |
| 2-Nitro-4-(trifluoroMethoxy)aniline |