NPS 2390 structure
|
Common Name | NPS 2390 | ||
|---|---|---|---|---|
| CAS Number | 226878-01-9 | Molecular Weight | 307.389 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 542.4±30.0 °C at 760 mmHg | |
| Molecular Formula | C19H21N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 281.9±24.6 °C | |
Use of NPS 2390NPS 2390 is a noncompetitive antagonist of mGluR1 and mGluR5[1]. NPS 2390 is also a potent CaSR (calcium-sensing receptor) inhibitor[2][3]. |
| Name | N-(1-adamantyl)quinoxaline-2-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Description | NPS 2390 is a noncompetitive antagonist of mGluR1 and mGluR5[1]. NPS 2390 is also a potent CaSR (calcium-sensing receptor) inhibitor[2][3]. |
|---|---|
| Related Catalog | |
| Target |
mGluR1 mGluR5 |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 542.4±30.0 °C at 760 mmHg |
| Molecular Formula | C19H21N3O |
| Molecular Weight | 307.389 |
| Flash Point | 281.9±24.6 °C |
| Exact Mass | 307.168457 |
| PSA | 54.88000 |
| LogP | 3.65 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Index of Refraction | 1.658 |
| InChIKey | ZKFVOZCCAXQXBU-UHFFFAOYSA-N |
| SMILES | O=C(NC12CC3CC(CC(C3)C1)C2)c1cnc2ccccc2n1 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| N-(tricyclo[3.3.1.1]dec-1-yl)quinoxaline-2-carboxamide |
| 2-quinoxaline-carboxamide-N-adamantan-1-yl |
| N-(Adamantan-1-yl)-2-quinoxalinecarboxamide |
| 2-Quinoxalinecarboxamide, N-tricyclo[3.3.1.1]dec-1-yl- |
| Quinoxaline-2-carboxylic acid adamantan-1-ylamide |
| NPS 2390 |