5,7,4'-trihydroxy-3,6-dimethoxyflavone structure
|
Common Name | 5,7,4'-trihydroxy-3,6-dimethoxyflavone | ||
|---|---|---|---|---|
| CAS Number | 22697-65-0 | Molecular Weight | 330.29 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 630.4±55.0 °C at 760 mmHg | |
| Molecular Formula | C17H14O7 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 236.4±25.0 °C | |
| Symbol |
GHS06, GHS09 |
Signal Word | Danger | |
Use of 5,7,4'-trihydroxy-3,6-dimethoxyflavone3,6-Dimethoxyapigenin is a flavone that can be isolated from Centaurea nervosa[1]. |
| Name | 5,7-dihydroxy-2-(4-hydroxyphenyl)-3,6-dimethoxychromen-4-one |
|---|---|
| Synonym | More Synonyms |
| Description | 3,6-Dimethoxyapigenin is a flavone that can be isolated from Centaurea nervosa[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 630.4±55.0 °C at 760 mmHg |
| Molecular Formula | C17H14O7 |
| Molecular Weight | 330.29 |
| Flash Point | 236.4±25.0 °C |
| Exact Mass | 330.073944 |
| PSA | 109.36000 |
| LogP | 1.80 |
| Vapour Pressure | 0.0±1.9 mmHg at 25°C |
| Index of Refraction | 1.701 |
| InChIKey | DDNPCXHBFYJXBJ-UHFFFAOYSA-N |
| SMILES | COc1c(O)cc2oc(-c3ccc(O)cc3)c(OC)c(=O)c2c1O |
| Storage condition | ?20°C |
| Symbol |
GHS06, GHS09 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301-H410 |
| Precautionary Statements | P273-P301 + P310-P501 |
| Hazard Codes | T,N |
| Risk Phrases | 25-50 |
| Safety Phrases | 45-61 |
| RIDADR | UN 2811 6.1 / PGIII |
| HS Code | 2914509090 |
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|
The major flavonoid of Dodonaea angustifolia.
Fitoterapia 71(5) , 602-4, (2000) The major leaf flavonoid of Dodonaea angustifolia, an important South African traditional medicine, has been identified as 5,7,4'-trihydroxy-3,6-dimethoxyflavone (1). |
| 5,7-Dihydroxy-2-(4-hydroxyphenyl)-3,6-dimethoxy-4H-chromen-4-one |
| 6-methoxykaempferol 3-methyl ether |
| 6-hydroxykaempferol 3,6-dimethylether |
| 5,7-Dihydroxy-2-(4-hydroxyphenyl)-3,6-dimethoxy-4H-1-benzopyran-4-one |
| 4',5,7-trihydroxy-3,6-dimethoxyflavone |
| 6-methoxyisokaempferide |
| trihydroxy-flavone |
| 3,6-Dimethoxy-5,7,4' |
| 3,6-dimethoxyapigenin |
| 6-hydroxykaempherol 3,6-dimethyl ether |
| 5,7,4'-trihydroxy-3,6-dimethoxyflavone |