2,3,7,8-TETRAMETHYL-1,4,6,9-THIANTHRENETETRONE structure
|
Common Name | 2,3,7,8-TETRAMETHYL-1,4,6,9-THIANTHRENETETRONE | ||
|---|---|---|---|---|
| CAS Number | 22698-81-3 | Molecular Weight | 332.39400 | |
| Density | 1.48g/cm3 | Boiling Point | 442.8ºC at 760mmHg | |
| Molecular Formula | C16H12O4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 189ºC | |
| Name | 2,3,7,8-tetramethylthianthrene-1,4,6,9-tetrone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.48g/cm3 |
|---|---|
| Boiling Point | 442.8ºC at 760mmHg |
| Molecular Formula | C16H12O4S2 |
| Molecular Weight | 332.39400 |
| Flash Point | 189ºC |
| Exact Mass | 332.01800 |
| PSA | 124.76000 |
| LogP | 2.22820 |
| Vapour Pressure | 4.86E-08mmHg at 25°C |
| Index of Refraction | 1.676 |
| InChIKey | XHXPIGHXTFVVOD-UHFFFAOYSA-N |
| SMILES | Cc1c(C)c(=O)c2sc3c(=O)c(C)c(C)c(=O)c3sc2c1=O |
| HS Code | 2934999090 |
|---|
|
~23%
2,3,7,8-TETRAME... CAS#:22698-81-3 |
| Literature: Mendez-Rojas, Miguel A.; Bodige, Satish G.; Ejsmont, Krzysztof; Watson, William H. Journal of Chemical Crystallography, 2001 , vol. 31, # 1 p. 17 - 28 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1,4,6,9-tetraoxo-2,3,7,8-tetramethyl-1,4,6,9-tetrahydro-thianthrene |
| 2,3,7,8-Tetramethyl-1,4,6,9-thianthrenetetrone |
| 2,3,7,8-tetramethylthianthrene-1,4,6,9-tetraone |