2,3-Dibromo-5,6-dimethyl-1,4-benzoquinone structure
|
Common Name | 2,3-Dibromo-5,6-dimethyl-1,4-benzoquinone | ||
|---|---|---|---|---|
| CAS Number | 38969-08-3 | Molecular Weight | 293.94000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H6Br2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,3-Dibromo-5,6-dimethyl-1,4-benzoquinone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H6Br2O2 |
|---|---|
| Molecular Weight | 293.94000 |
| Exact Mass | 291.87300 |
| PSA | 34.14000 |
| LogP | 2.47600 |
| InChIKey | CAXBSOUSWQHJFJ-UHFFFAOYSA-N |
| SMILES | CC1=C(C)C(=O)C(Br)=C(Br)C1=O |
| HS Code | 2914700090 |
|---|
|
~%
2,3-Dibromo-5,6... CAS#:38969-08-3 |
| Literature: Bodige, Satish G.; Mendez-Rojas, Miguel; Watson, William H. Journal of Chemical Crystallography, 1999 , vol. 29, # 8 p. 931 - 942 |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 2,3-dibromo-5,6-dimethylbenzo-1,4-quinone |
| 2,3-dibromoxyloquinone |
| 2,3-dibromo-5,6-dimethylbenzoquinone |
| 2,3-Dibromo-5,6-dimethyl-p-benzoquinone |