1,2-bis(4-nitrophenyl)hydrazine structure
|
Common Name | 1,2-bis(4-nitrophenyl)hydrazine | ||
|---|---|---|---|---|
| CAS Number | 22719-28-4 | Molecular Weight | 274.23200 | |
| Density | 1.524g/cm3 | Boiling Point | 388.8ºC at 760 mmHg | |
| Molecular Formula | C12H10N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 189ºC | |
| Name | 1,2-bis(4-nitrophenyl)hydrazine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.524g/cm3 |
|---|---|
| Boiling Point | 388.8ºC at 760 mmHg |
| Molecular Formula | C12H10N4O4 |
| Molecular Weight | 274.23200 |
| Flash Point | 189ºC |
| Exact Mass | 274.07000 |
| PSA | 115.70000 |
| LogP | 4.13440 |
| Vapour Pressure | 2.97E-06mmHg at 25°C |
| Index of Refraction | 1.752 |
| InChIKey | YYEMGPZOKZIEAB-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(NNc2ccc([N+](=O)[O-])cc2)cc1 |
| HS Code | 2928000090 |
|---|
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 4,4'-Dinitrohydrazobenzene |