1,2-Bis(4-nitrophenyl)-1,2-ethanedione structure
|
Common Name | 1,2-Bis(4-nitrophenyl)-1,2-ethanedione | ||
|---|---|---|---|---|
| CAS Number | 6067-45-4 | Molecular Weight | 300.223 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 532.3±35.0 °C at 760 mmHg | |
| Molecular Formula | C14H8N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 270.3±18.7 °C | |
| Name | 1,2-bis(4-nitrophenyl)ethane-1,2-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 532.3±35.0 °C at 760 mmHg |
| Molecular Formula | C14H8N2O6 |
| Molecular Weight | 300.223 |
| Flash Point | 270.3±18.7 °C |
| Exact Mass | 300.038239 |
| PSA | 125.78000 |
| LogP | 3.30 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Index of Refraction | 1.649 |
| InChIKey | YRKNWVLBLGRGRK-UHFFFAOYSA-N |
| SMILES | O=C(C(=O)c1ccc([N+](=O)[O-])cc1)c1ccc([N+](=O)[O-])cc1 |
| HS Code | 2914700090 |
|---|
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 1,2-Dione-Based Compound,5 |
| Ethanedione,bis(4-nitrophenyl) |
| 1,2-Bis(4-nitrophenyl)-1,2-ethanedione |
| 1,2-Bis-(4-nitro-phenyl)-ethane-1,2-dione |
| 4,4'-dinitro-benzil |
| 4,4'-dinitrobenzyl |
| para,para'-dinitrobenzil |
| 1,2-Ethanedione, 1,2-bis(4-nitrophenyl)- |