monoethanolamine oleate structure
|
Common Name | monoethanolamine oleate | ||
|---|---|---|---|---|
| CAS Number | 2272-11-9 | Molecular Weight | 343.54400 | |
| Density | 0.973g/cm3 | Boiling Point | 170.9ºC at 760mmHg | |
| Molecular Formula | C20H41NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 93.3ºC | |
Use of monoethanolamine oleateOleic (9-cis-Octadecenoic) acid ethanolamine consists of oleic acid and ethanolamine. Oleic acid ethanolamine has sclerotherapeutic activity. Oleic acid ethanolamine can cause inflammatory reaction in the intimal endothelium of the vein[1]. |
| Name | 2-aminoethanol,(Z)-octadec-9-enoic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Oleic (9-cis-Octadecenoic) acid ethanolamine consists of oleic acid and ethanolamine. Oleic acid ethanolamine has sclerotherapeutic activity. Oleic acid ethanolamine can cause inflammatory reaction in the intimal endothelium of the vein[1]. |
|---|---|
| Related Catalog | |
| Target |
Inflammation[1] |
| References |
| Density | 0.973g/cm3 |
|---|---|
| Boiling Point | 170.9ºC at 760mmHg |
| Molecular Formula | C20H41NO3 |
| Molecular Weight | 343.54400 |
| Flash Point | 93.3ºC |
| Exact Mass | 343.30900 |
| PSA | 83.55000 |
| LogP | 5.74620 |
| Vapour Pressure | 3.7E-06mmHg at 25°C |
| InChIKey | KGWDUNBJIMUFAP-KVVVOXFISA-N |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)O.NCCO |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| HS Code | 2922499990 |
|---|
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
|
Name: Liver toxicity in human assessed as induction of drug-induced liver injury by measuri...
Source: ChEMBL
Target: Homo sapiens
External Id: CHEMBL4029349
|
|
Name: Identifying Sarm1 Tir Hydrolase inhibitors through NAD-Glo assay
Source: 24386
Target: N/A
External Id: Sarm1 Tir NADase inhibitors screen
|
|
Name: Liver toxicity in human assessed as induction of drug-induced liver injury by measuri...
Source: ChEMBL
Target: Homo sapiens
External Id: CHEMBL4029350
|
|
Name: Inhibition of Escherichia coli GroEL expressed in Escherichia coliDH5alpha/Escherichi...
Source: ChEMBL
Target: Co-chaperonin GroES
External Id: CHEMBL4392938
|
|
Name: Inhibition of Escherichia coli GroEL expressed in Escherichia coli DH5alpha/Escherich...
Source: ChEMBL
Target: Co-chaperonin GroES
External Id: CHEMBL4392939
|
| Neosclerol |
| Monolate |
| Ethamolin |
| Moramin |
| Monoethanolamine oleate |
| ETHANOLAMINE OLEATE |
| Oldamin |
| Varicetin |
| Varex |