4,6-Dichloro-N-phenyl-1,3,5-triazin-2-amine structure
|
Common Name | 4,6-Dichloro-N-phenyl-1,3,5-triazin-2-amine | ||
|---|---|---|---|---|
| CAS Number | 2272-40-4 | Molecular Weight | 241.07700 | |
| Density | 1.515g/cm3 | Boiling Point | 441.8ºC at 760mmHg | |
| Molecular Formula | C9H6Cl2N4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 221ºC | |
| Name | 4,6-Dichloro-N-phenyl-1,3,5-triazin-2-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.515g/cm3 |
|---|---|
| Boiling Point | 441.8ºC at 760mmHg |
| Molecular Formula | C9H6Cl2N4 |
| Molecular Weight | 241.07700 |
| Flash Point | 221ºC |
| Exact Mass | 239.99700 |
| PSA | 53.93000 |
| LogP | 2.34390 |
| Vapour Pressure | 5.27E-08mmHg at 25°C |
| Index of Refraction | 1.674 |
| InChIKey | SACFASUHQGNXOD-UHFFFAOYSA-N |
| SMILES | Clc1nc(Cl)nc(Nc2ccccc2)n1 |
| HS Code | 2933699090 |
|---|
|
~96%
4,6-Dichloro-N-... CAS#:2272-40-4 |
| Literature: Chauhan, Kuldeep; Sharma, Moni; Shivahare, Rahul; Debnath, Utsab; Gupta, Suman; Prabhakar, Yenamandra S.; Chauhan, Prem M. S. ACS Medicinal Chemistry Letters, 2013 , vol. 4, # 11 p. 1108 - 1113 |
|
~%
4,6-Dichloro-N-... CAS#:2272-40-4 |
| Literature: Breithaupt, Dietmar Ernst; Schwack, Wolfgang Chemosphere, 2000 , vol. 41, # 9 p. 1401 - 1406 |
| HS Code | 2933699090 |
|---|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
| (4,6-Dichloro-[1,3,5]triazin-2-yl)-phenyl-amine |
| N-(4,6-dichloro-1,3,5-triazin-2-yl)-aniline |
| 2-anilino-4,6-dichloro-1,3,5-triazine |
| 2,4-dichloro-6-phenylamino-s-triazine |
| N-(4,6-dichloro-1,3,5-triazine-2-yl)-N-phenylamine |