6-chloro-2-N-(4-fluorophenyl)-4-N-phenyl-1,3,5-triazine-2,4-diamine structure
|
Common Name | 6-chloro-2-N-(4-fluorophenyl)-4-N-phenyl-1,3,5-triazine-2,4-diamine | ||
|---|---|---|---|---|
| CAS Number | 753494-70-1 | Molecular Weight | 315.73300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H11ClFN5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-chloro-2-N-(4-fluorophenyl)-4-N-phenyl-1,3,5-triazine-2,4-diamine |
|---|
| Molecular Formula | C15H11ClFN5 |
|---|---|
| Molecular Weight | 315.73300 |
| Exact Mass | 315.06900 |
| PSA | 65.96000 |
| LogP | 3.64620 |
| InChIKey | AUEOSOVBMOMURL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC2=NC(=NC(=N2)Cl)NC3=CC=C(C=C3)F |
|
~73%
6-chloro-2-N-(4... CAS#:753494-70-1 |
| Literature: Solankee, Anjani; Thakor, Indrajit Indian Journal of Chemistry - Section B Organic and Medicinal Chemistry, 2006 , vol. 45, # 2 p. 517 - 522 |
|
~%
6-chloro-2-N-(4... CAS#:753494-70-1 |
| Literature: Zheng, Mingfang; Xu, Chenghui; Ma, Jianwei; Sun, Yan; Du, Feifei; Liu, Hong; Lin, Liping; Li, Chuan; Ding, Jian; Chen, Kaixian; Jiang, Hualiang Bioorganic and Medicinal Chemistry, 2007 , vol. 15, # 4 p. 1815 - 1827 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |