Benzoic acid,2-[(1-carboxyethyl)amino] structure
|
Common Name | Benzoic acid,2-[(1-carboxyethyl)amino] | ||
|---|---|---|---|---|
| CAS Number | 2274-50-2 | Molecular Weight | 209.19900 | |
| Density | 1.399g/cm3 | Boiling Point | 472.4ºC at 760 mmHg | |
| Molecular Formula | C10H11NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 239.5ºC | |
| Name | 2-(1-carboxyethylamino)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.399g/cm3 |
|---|---|
| Boiling Point | 472.4ºC at 760 mmHg |
| Molecular Formula | C10H11NO4 |
| Molecular Weight | 209.19900 |
| Flash Point | 239.5ºC |
| Exact Mass | 209.06900 |
| PSA | 86.63000 |
| LogP | 1.34280 |
| Vapour Pressure | 9.95E-10mmHg at 25°C |
| Index of Refraction | 1.636 |
| InChIKey | QDHUFUMCOCIMMV-UHFFFAOYSA-N |
| SMILES | CC(Nc1ccccc1C(=O)O)C(=O)O |
| HS Code | 2922499990 |
|---|
|
~84%
Benzoic acid,2-... CAS#:2274-50-2 |
| Literature: Dominguez, Juan Carlos Rodriguez; Gang, Xiao; Kirsch, Gilbert Synthesis, 2009 , # 14 art. no. Z03009SS, p. 2345 - 2348 |
|
~%
Benzoic acid,2-... CAS#:2274-50-2 |
| Literature: van Alphen Recueil des Travaux Chimiques des Pays-Bas, 1942 , vol. 61, p. 895 |
|
~%
Benzoic acid,2-... CAS#:2274-50-2 |
| Literature: Capuano,L.; Zander,M. Justus Liebigs Annalen der Chemie, 1968 , vol. 712, p. 73 - 78 |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| N-(2-carboxy-phenyl)-alanine |
| N-(1-Carboxy-aethyl)-anthranilsaeure |
| N-(2-Carboxy-phenyl)-DL-alanin |
| N-(1-carboxy-ethyl)-anthranilic acid |
| 2-(1-carboxy-ethylamino)-benzoic acid |
| phenylalanine-o-carboxylic acid |