Vamidothion structure
|
Common Name | Vamidothion | ||
|---|---|---|---|---|
| CAS Number | 2275-23-2 | Molecular Weight | 287.337 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C8H18NO4PS2 | Melting Point | 43ºC | |
| MSDS | Chinese | Flash Point | 2 °C | |
| Symbol |
GHS02, GHS07 |
Signal Word | Danger | |
| Name | vamidothion |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Melting Point | 43ºC |
| Molecular Formula | C8H18NO4PS2 |
| Molecular Weight | 287.337 |
| Flash Point | 2 °C |
| Exact Mass | 287.041473 |
| PSA | 125.04000 |
| LogP | 0.15 |
| Index of Refraction | 1.508 |
| InChIKey | LESVOLZBIFDZGS-UHFFFAOYSA-N |
| SMILES | CNC(=O)C(C)SCCSP(=O)(OC)OC |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
MUTATION DATA
|
| Symbol |
GHS02, GHS07 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H225-H302 + H312 + H332-H319 |
| Precautionary Statements | P210-P280-P305 + P351 + P338 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | T: Toxic;N: Dangerous for the environment; |
| Risk Phrases | R21;R25;R50 |
| Safety Phrases | S36/37-S45-S61-S16 |
| RIDADR | UN 2811 |
| RTECS | TF7900000 |
| Packaging Group | III |
| Hazard Class | 6.1(b) |
|
Determination of polar organophosphorus pesticides in water samples by hydrophilic interaction liquid chromatography with tandem mass spectrometry.
Rapid Commun. Mass Spectrom. 22(14) , 2203-10, (2008) A method combining hydrophilic interaction liquid chromatography (HILIC) with tandem mass spectrometry (MS/MS) was developed for the determination of polar organophosphorus pesticides (OPPs; acephate,... |
|
|
Evaluation of residual levels of benomyl, methyl parathion, diuron, and vamidothion in pineapple pulp and bagasse (Smooth cayenne).
J. Agric. Food Chem. 48(11) , 5750-3, (2000) The objective of this research was to study the residual levels of benomyl, methyl parathion, diuron, and vamidothion in pineapple bagasse and pulp. Benomyl (benlate), methyl parathion (Folidol 600), ... |
| O,O-dimethyl S-[2-[[1-methyl-2-(methylamino)-2-oxoethyl]thio]ethyl] phosphorothioate |
| O,O-Dimethyl S-(2-{[1-(methylamino)-1-oxo-2-propanyl]sulfanyl}ethyl) phosphorothioate |
| Kilval |
| (RS)-2-(2-dimethoxyphosphinoylthioethylthio)-N-methylpropionamide |
| 2-(2-dimethoxyphosphorylsulfanylethylsulfanyl)-N-methylpropanamide |
| O,O-Dimethyl S-[2-(1-methyl-2-methylamino-2-oxoethylthio)ethyl] phosphorothioate |
| O,O-Dimethyl S-(2-((1-methyl-2-(methylamino)-2-oxoethyl)thio)ethyl) phosphorothioate (9CI) |
| O,O-Dimethyl S-(2-{[1-(methylamino)-1-oxopropan-2-yl]sulfanyl}ethyl) phosphorothioate |
| rac-O,O-dimethyl S-(2-{[(2R)-1-(methylamino)-1-oxopropan-2-yl]sulfanyl}ethyl) phosphorothioate |
| O,O-Dimethyl-S-(2-{[1-(methylamino)-1-oxopropan-2-yl]sulfanyl}ethyl)thiophosphat |
| Vamidothion |
| MFCD00055442 |
| Phosphorothioic acid, O,O-dimethyl S-[2-[[1-methyl-2-(methylamino)-2-oxoethyl]thio]ethyl] ester |
| EINECS 218-894-8 |
| NPH 83 |
| O,O-dimethyl S-(RS)-2-(1-methylcarbamoylethylthio)ethyl phosphorothioate |
| Thiophosphate de S-(2-{[1-(méthylamino)-1-oxo-2-propanyl]sulfanyl}éthyle) et de O,O-diméthyle |
| Vamidoate |
| O,O-Dimethyl-S-(2-{[1-(methylamino)-1-oxo-2-propanyl]sulfanyl}ethyl)thiophosphat |
| Trucidor |