Benzeneacetyl chloride,2-nitro- structure
|
Common Name | Benzeneacetyl chloride,2-nitro- | ||
|---|---|---|---|---|
| CAS Number | 22751-23-1 | Molecular Weight | 199.59100 | |
| Density | 1.399g/cm3 | Boiling Point | 301ºC at 760mmHg | |
| Molecular Formula | C8H6ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 135.8ºC | |
| Name | 2-(2-nitrophenyl)acetyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.399g/cm3 |
|---|---|
| Boiling Point | 301ºC at 760mmHg |
| Molecular Formula | C8H6ClNO3 |
| Molecular Weight | 199.59100 |
| Flash Point | 135.8ºC |
| Exact Mass | 199.00400 |
| PSA | 62.89000 |
| LogP | 2.42590 |
| Vapour Pressure | 0.00108mmHg at 25°C |
| Index of Refraction | 1.576 |
| InChIKey | BKTDBYAOZVFUNR-UHFFFAOYSA-N |
| SMILES | O=C(Cl)Cc1ccccc1[N+](=O)[O-] |
| HS Code | 2916399090 |
|---|
|
~96%
Benzeneacetyl c... CAS#:22751-23-1 |
| Literature: Peet, Norton P.; Sunder, Shyam Journal of Heterocyclic Chemistry, 1983 , vol. 20, p. 1355 - 1357 |
| Precursor 1 | |
|---|---|
| DownStream 10 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| (2-nitrophenyl)acetyl chloride |
| (2-Nitro-phenyl)-acetylchlorid |
| 2-Nitrobenzeneacetyl chloride |
| Benzeneacetyl chloride,2-nitro |
| o-Nitrophenylacetyl chloride |