Isoallolithocholic acid structure
|
Common Name | Isoallolithocholic acid | ||
|---|---|---|---|---|
| CAS Number | 2276-93-9 | Molecular Weight | 376.57300 | |
| Density | 1.073g/cm3 | Boiling Point | 511ºC at 760mmHg | |
| Molecular Formula | C24H40O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 276.9ºC | |
Use of Isoallolithocholic acidAlloisolithocholic acid (AILCA) activates large-conductance calcium-activated potassium (BK) channels with an EC50 value of 44.21 μM in Xenopus oocytes[1]. |
| Name | (4R)-4-[(3S,5S,8R,9S,10S,13R,14S,17R)-3-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Alloisolithocholic acid (AILCA) activates large-conductance calcium-activated potassium (BK) channels with an EC50 value of 44.21 μM in Xenopus oocytes[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.073g/cm3 |
|---|---|
| Boiling Point | 511ºC at 760mmHg |
| Molecular Formula | C24H40O3 |
| Molecular Weight | 376.57300 |
| Flash Point | 276.9ºC |
| Exact Mass | 376.29800 |
| PSA | 57.53000 |
| LogP | 5.50710 |
| Vapour Pressure | 1.4E-12mmHg at 25°C |
| Index of Refraction | 1.528 |
| InChIKey | SMEROWZSTRWXGI-XBESLWPFSA-N |
| SMILES | CC(CCC(=O)O)C1CCC2C3CCC4CC(O)CCC4(C)C3CCC12C |
| lithocholic acid |
| Isoallolithocholate |
| 3b-Hydroxy-5a-cholanate |
| Isoallolithocholic acid |
| 3b-Hydroxy-5a-cholanoate |
| Alloisolithocholic acid |
| 3b-hydroxy-5a-cholan-24-oic acid |
| Isolithocholic acid |