bendiocarb structure
|
Common Name | bendiocarb | ||
|---|---|---|---|---|
| CAS Number | 22781-23-3 | Molecular Weight | 223.225 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 298.8±40.0 °C at 760 mmHg | |
| Molecular Formula | C11H13NO4 | Melting Point | 128-130ºC | |
| MSDS | Chinese USA | Flash Point | 134.5±27.3 °C | |
| Symbol |
GHS06, GHS09 |
Signal Word | Danger | |
| Name | bendiocarb |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 298.8±40.0 °C at 760 mmHg |
| Melting Point | 128-130ºC |
| Molecular Formula | C11H13NO4 |
| Molecular Weight | 223.225 |
| Flash Point | 134.5±27.3 °C |
| Exact Mass | 223.084457 |
| PSA | 56.79000 |
| LogP | 1.86 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.523 |
| InChIKey | XEGGRYVFLWGFHI-UHFFFAOYSA-N |
| SMILES | CNC(=O)Oc1cccc2c1OC(C)(C)O2 |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS06, GHS09 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301-H312-H331-H410 |
| Precautionary Statements | P261-P273-P280-P301 + P310-P311-P501 |
| Personal Protective Equipment | Eyeshields;Faceshields;Gloves;type P2 (EN 143) respirator cartridges |
| Hazard Codes | T: Toxic;N: Dangerous for the environment; |
| Risk Phrases | R21;R23/25;R50/53 |
| Safety Phrases | S22-S36/37-S45-S60-S61 |
| RIDADR | 2757 |
| RTECS | FC1140000 |
| Packaging Group | II |
| Hazard Class | 6.1(a) |
| HS Code | 2932999012 |
| HS Code | 2932999012 |
|---|---|
| Summary | 2932999012 2,2-dimethylbenzo[d][1,3]dioxol-4-yl methylcarbamate。supervision conditions:s(import or export registration certificate for pesticides)。VAT:17.0%。tax rebate rate:13.0%。MFN tarrif:6.5%。general tariff:20.0% |
|
CYP6 P450 enzymes and ACE-1 duplication produce extreme and multiple insecticide resistance in the malaria mosquito Anopheles gambiae.
PLoS Genet. 10(3) , e1004236, (2014) Malaria control relies heavily on pyrethroid insecticides, to which susceptibility is declining in Anopheles mosquitoes. To combat pyrethroid resistance, application of alternative insecticides is adv... |
|
|
Mining biologically-active molecules for inhibitors of fatty acid amide hydrolase (FAAH): Identification of phenmedipham and amperozide as FAAH inhibitors
Bioorg. Med. Chem. Lett. 19 , 6793-6, (2009) The screening of known medicinal agents against new biological targets has been shown to be a valuable approach for revealing new pharmacology of marketed compounds. Recently, carbamate, urea and keto... |
|
|
Insecticide resistance in two Aedes aegypti (Diptera: Culicidae) strains from Costa Rica.
J. Med. Entomol. 50(2) , 352-61, (2013) Dengue (family Flaviridae, genus Flavivirus, DENV) and dengue hemorrhagic fever (DHF) are presently important public health problems in Costa Rica. The primary strategy for disease control is based on... |
| Multamat |
| 2,2-dimethyl-1,3-benzodioxol-4-yl N-methylcarbamate |
| Ficam W |
| Dycarb |
| Turcam |
| Ficam |
| bendiocarb |
| Niomil |
| 2,2-Dimethyl-1,3-benzodioxol-4-yl methylcarbamate |
| Bencarbate |
| EINECS 245-216-8 |
| MFCD00078629 |
| 2,2-dimethyl-2H-1,3-benzodioxol-4-yl methylcarbamate |
| 1,3-Benzodioxol-4-ol, 2,2-dimethyl-, methylcarbamate |
| T56 BO DO CHJ FOVM1 |
| 1315404 |
| 2,3-isopropylidenedioxyphenyl methylcarbamate |
| Garvox |
| Seedox |
| (2,2-dimethyl-1,3-benzodioxol-4-yl) N-methylcarbamate |
| 2,2-dimethyl-1,3-benzodioxol-4-yl H-methylcarbamate |