Z-D-Trp-OH structure
|
Common Name | Z-D-Trp-OH | ||
|---|---|---|---|---|
| CAS Number | 2279-15-4 | Molecular Weight | 338.357 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 619.1±55.0 °C at 760 mmHg | |
| Molecular Formula | C19H18N2O4 | Melting Point | 122-124°C | |
| MSDS | N/A | Flash Point | 328.2±31.5 °C | |
| Name | (2R)-3-(1H-indol-3-yl)-2-(phenylmethoxycarbonylamino)propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 619.1±55.0 °C at 760 mmHg |
| Melting Point | 122-124°C |
| Molecular Formula | C19H18N2O4 |
| Molecular Weight | 338.357 |
| Flash Point | 328.2±31.5 °C |
| Exact Mass | 338.126648 |
| PSA | 91.42000 |
| LogP | 3.50 |
| Vapour Pressure | 0.0±1.9 mmHg at 25°C |
| Index of Refraction | 1.662 |
| InChIKey | AHYFYYVVAXRMKB-QGZVFWFLSA-N |
| SMILES | O=C(NC(Cc1c[nH]c2ccccc12)C(=O)O)OCc1ccccc1 |
| Storage condition | Store at RT. |
| Hazard Codes | Xi |
|---|---|
| Safety Phrases | S22-S24/25 |
| HS Code | 2933990090 |
|
~89%
Z-D-Trp-OH CAS#:2279-15-4 |
| Literature: Hewitt, Peter R.; Cleator, Ed; Ley, Steven V. Organic and Biomolecular Chemistry, 2004 , vol. 2, # 17 p. 2415 - 2417 |
|
~79%
Z-D-Trp-OH CAS#:2279-15-4 |
| Literature: Synthetic Communications, , vol. 18, # 4 p. 441 - 444 |
|
~%
Z-D-Trp-OH CAS#:2279-15-4 |
| Literature: Journal of Biological Chemistry, , vol. 179, p. 815,817 |
|
~%
Z-D-Trp-OH CAS#:2279-15-4 |
| Literature: Chemistry Letters, , p. 1125 - 1128 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Name: Inhibition of recombinant stromelysin catalytic domain (SCD)
Source: ChEMBL
Target: Stromelysin-1
External Id: CHEMBL812384
|
|
Name: Inhibition of recombinant full length stromelysin (FLS)
Source: ChEMBL
Target: Stromelysin-1
External Id: CHEMBL812383
|
|
Name: In vitro inhibition of recombinant stromelysin catalytic domain.
Source: ChEMBL
Target: Stromelysin-1
External Id: CHEMBL810391
|
|
Name: Inhibition of recombinant full length stromelysin (FLS).
Source: ChEMBL
Target: Stromelysin-1
External Id: CHEMBL810390
|
| Nalpha-Cbz-D-tryptophan |
| N-[(Benzyloxy)carbonyl]-D-tryptophan |
| Z-D-Trp-OH |
| Cbz-D-Trp-OH |
| Nα-Cbz-D-tryptophan |
| N-[(Benzyloxy)carbonyl]tryptophan |
| CBZ-D-TRYPTOPHAN |
| benzyloxycarbonyltryptophan |
| Nα-Carbobenzoxy-D-tryptophan |
| N-Cbz-D-Trp |
| MFCD00037945 |
| N-Cbz-D-Tryptophan |
| 2-{[(Benzyloxy)carbonyl]amino}-3-(1H-indol-3-yl)propanoic acid |
| Nalpha-Carbobenzoxy-D-tryptophan |
| (R)-2-(((Benzyloxy)carbonyl)amino)-3-(1H-indol-3-yl)propanoic acid |