2,2'-[oxybis(ethane-2,1-diyloxy)]bisethyl diacetate structure
|
Common Name | 2,2'-[oxybis(ethane-2,1-diyloxy)]bisethyl diacetate | ||
|---|---|---|---|---|
| CAS Number | 22790-12-1 | Molecular Weight | 278.29900 | |
| Density | 1.101g/cm3 | Boiling Point | 341.1ºC at 760mmHg | |
| Molecular Formula | C12H22O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 146.4ºC | |
| Name | 2-[2-[2-(2-acetyloxyethoxy)ethoxy]ethoxy]ethyl acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.101g/cm3 |
|---|---|
| Boiling Point | 341.1ºC at 760mmHg |
| Molecular Formula | C12H22O7 |
| Molecular Weight | 278.29900 |
| Flash Point | 146.4ºC |
| Exact Mass | 278.13700 |
| PSA | 80.29000 |
| LogP | 0.16240 |
| Vapour Pressure | 8.25E-05mmHg at 25°C |
| Index of Refraction | 1.438 |
| InChIKey | DXYGJDUJLDXFOD-UHFFFAOYSA-N |
| SMILES | CC(=O)OCCOCCOCCOCCOC(C)=O |
|
~92%
2,2'-[oxybis(et... CAS#:22790-12-1 |
| Literature: Eshghi, Hossein; Shafieyoon, Parvaneh Journal of Chemical Research, 2004 , # 12 p. 802 - 805 |
|
~%
2,2'-[oxybis(et... CAS#:22790-12-1 |
| Literature: Wurtz Annales de Chimie (Cachan, France), 1863 , vol. <3> 69, p. 321 Justus Liebigs Annalen der Chemie, 1862 , vol. 122, p. 354 |
| Precursor 4 | |
|---|---|
| DownStream 0 | |
| tetraethylene glycol diacetate |
| 13-oxo-3,6,9,12-tetraoxatetradec-1-yl acetate |
| EINECS 245-221-5 |