Ethyl [3-(trifluoromethyl)phenoxy]acetate structure
|
Common Name | Ethyl [3-(trifluoromethyl)phenoxy]acetate | ||
|---|---|---|---|---|
| CAS Number | 22897-99-0 | Molecular Weight | 248.198 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 263.0±40.0 °C at 760 mmHg | |
| Molecular Formula | C11H11F3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 109.5±22.2 °C | |
| Name | ethyl 2-[3-(trifluoromethyl)phenoxy]acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 263.0±40.0 °C at 760 mmHg |
| Molecular Formula | C11H11F3O3 |
| Molecular Weight | 248.198 |
| Flash Point | 109.5±22.2 °C |
| Exact Mass | 248.066025 |
| PSA | 35.53000 |
| LogP | 3.00 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.449 |
| InChIKey | LEKNNERDFCDITP-UHFFFAOYSA-N |
| SMILES | CCOC(=O)COc1cccc(C(F)(F)F)c1 |
| HS Code | 2918990090 |
|---|
|
~%
Ethyl [3-(trifl... CAS#:22897-99-0 |
| Literature: American Cyanamid Company Patent: US4297516 A1, 1981 ; |
|
~%
Ethyl [3-(trifl... CAS#:22897-99-0 |
| Literature: Ono Pharmaceutical Co., Ltd. Patent: US3978229 A1, 1976 ; |
|
~%
Ethyl [3-(trifl... CAS#:22897-99-0 |
| Literature: Selliah, Robert; Dantanarayana, Anura; Haggard, Karen; Egan, Judith; Do, Ernest U.; May, Jesse A. Journal of Labelled Compounds and Radiopharmaceuticals, 2001 , vol. 44, # 3 p. 173 - 183 |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| ethyl {[3-(trifluoromethyl)phenyl]oxy}acetate |
| Ethyl [3-(trifluoromethyl)phenoxy]acetate |
| ethyl (3-trifluoromethylphenoxy)acetate |
| ethyl m-trifluoromethylphenoxyacetate |
| Ethyl 3-(Trifluoromethyl)phenoxyacetate |
| Acetic acid, 2-[3-(trifluoromethyl)phenoxy]-, ethyl ester |
| ETHYL 2-(3-(TRIFLUOROMETHYL)PHENOXY)ACETATE |