Ethyl [3-(trifluoromethyl)phenyl]acetate structure
|
Common Name | Ethyl [3-(trifluoromethyl)phenyl]acetate | ||
|---|---|---|---|---|
| CAS Number | 331-33-9 | Molecular Weight | 232.199 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 231.1±35.0 °C at 760 mmHg | |
| Molecular Formula | C11H11F3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 66.8±18.2 °C | |
| Name | ethyl 2-[3-(trifluoromethyl)phenyl]acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 231.1±35.0 °C at 760 mmHg |
| Molecular Formula | C11H11F3O2 |
| Molecular Weight | 232.199 |
| Flash Point | 66.8±18.2 °C |
| Exact Mass | 232.071121 |
| PSA | 26.30000 |
| LogP | 3.07 |
| Vapour Pressure | 0.1±0.5 mmHg at 25°C |
| Index of Refraction | 1.452 |
| InChIKey | JDSJLOLGIHAOOZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)Cc1cccc(C(F)(F)F)c1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2916399090 |
|
~90%
Ethyl [3-(trifl... CAS#:331-33-9 |
| Literature: ABBVIE INC.; BAYBURT, Erol K.; CLAPHAM, Bruce; COX, Phil B.; DAANEN, Jerome F.; GOMTSYAN, Arthur; KORT, Michael E.; KYM, Philip R.; VOIGHT, Eric A.; SCHMIDT, Robert G.; DART, Michael J.; GFESSER, Gregory Patent: WO2013/62966 A2, 2013 ; Location in patent: Paragraph 335; 336 ; |
|
~%
Ethyl [3-(trifl... CAS#:331-33-9 |
| Literature: US4711898 A1, ; |
| Precursor 4 | |
|---|---|
| DownStream 8 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 3-(trifluoromethyl)phenyl acetate |
| ethyl 3-(trifluoromethyl)phenylacetate |
| <3-(Trifluormethyl)phenyl>essigsaeure-ethylester |
| ethyl m-trifluoromethylphenylacetate |
| m-(trifluoromethyl)phenyl>acetate |
| Benzeneacetic acid, 3-(trifluoromethyl)-, ethyl ester |
| Ethyl [3-(trifluoromethyl)phenyl]acetate |
| ethyl 2-(3-(trifluoromethyl)phenyl)acetate |