Lacutoclax structure
|
Common Name | Lacutoclax | ||
|---|---|---|---|---|
| CAS Number | 2291166-56-6 | Molecular Weight | 923.52 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C48H55ClN8O7S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of LacutoclaxLacutoclax is a Bcl-2 inhibitor with antineoplastic activity[1]. |
| Name | Lacutoclax |
|---|
| Description | Lacutoclax is a Bcl-2 inhibitor with antineoplastic activity[1]. |
|---|---|
| Related Catalog | |
| Target |
Bcl-2[1] |
| References |
| Molecular Formula | C48H55ClN8O7S |
|---|---|
| Molecular Weight | 923.52 |
| InChIKey | CCDRQWAEZGRMTP-WJOKGBTCSA-N |
| SMILES | CC1CN(c2cc(N3CCN(CC4=C(c5ccc(Cl)cc5)CC(C)(C)CC4)CC3)ccc2C(=O)NS(=O)(=O)c2ccc(NCC3CCOCC3)c([N+](=O)[O-])c2)c2cc3cc[nH]c3nc2O1 |