9H-Purin-6-amine,9,9'-(1,6-hexanediyl)bis- structure
|
Common Name | 9H-Purin-6-amine,9,9'-(1,6-hexanediyl)bis- | ||
|---|---|---|---|---|
| CAS Number | 22917-81-3 | Molecular Weight | 352.39700 | |
| Density | 1.6g/cm3 | Boiling Point | 690.5ºC at 760 mmHg | |
| Molecular Formula | C16H20N10 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 371.4ºC | |
| Name | 9-[6-(6-aminopurin-9-yl)hexyl]purin-6-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6g/cm3 |
|---|---|
| Boiling Point | 690.5ºC at 760 mmHg |
| Molecular Formula | C16H20N10 |
| Molecular Weight | 352.39700 |
| Flash Point | 371.4ºC |
| Exact Mass | 352.18700 |
| PSA | 139.24000 |
| LogP | 2.55340 |
| Vapour Pressure | 6.46E-19mmHg at 25°C |
| Index of Refraction | 1.827 |
| InChIKey | GZSXAOIZHBUGGC-UHFFFAOYSA-N |
| SMILES | Nc1ncnc2c1ncn2CCCCCCn1cnc2c(N)ncnc21 |
|
~%
9H-Purin-6-amin... CAS#:22917-81-3 |
| Literature: Itahara, Toshio Journal of the Chemical Society. Perkin Transactions 2, 1996 , vol. 1996, # 12 p. 2695 - 2700 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 9,9'-Hexamethylen-bisadenin |
| 9H,9'H-9,9'-hexane-1,6-diyl-bis-purin-6-ylamine |