Di-tert-butyl Chloromethyl Phosphate structure
|
Common Name | Di-tert-butyl Chloromethyl Phosphate | ||
|---|---|---|---|---|
| CAS Number | 229625-50-7 | Molecular Weight | 258.680 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 272.9±23.0 °C at 760 mmHg | |
| Molecular Formula | C9H20ClO4P | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 139.0±30.2 °C | |
| Symbol |
GHS06 |
Signal Word | Danger | |
| Name | ditert-butyl chloromethyl phosphate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 272.9±23.0 °C at 760 mmHg |
| Molecular Formula | C9H20ClO4P |
| Molecular Weight | 258.680 |
| Flash Point | 139.0±30.2 °C |
| Exact Mass | 258.078766 |
| PSA | 54.57000 |
| LogP | 2.17 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.436 |
| InChIKey | LNJAJHJFSKUCIR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OP(=O)(OCCl)OC(C)(C)C |
| Storage condition | ?20°C |
| HS Code | 2919900090 |
|---|---|
| Summary | 2919900090 other phosphoric esters and their salts, including lactophosphates; their halogenated, sulphonated, nitrated or nitrosated derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
| phosphoric acid di-t-butyl ester chloromethyl ester |
| di-tert-butyl chloromethyl phosphonate |
| phosphoric acid di-tert-butyl ester chloromethyl ester |
| Di-tert-butyl chloromethyl phosphate |
| di-tert-butyl chloromethylene phosphate ester |
| chloromethyl di-tert-butyl phosphate |
| Phosphoric acid di-tert-butyl chloromethyl ester |