2-Propen-1-one,1-(3-bromophenyl)-3-phenyl-, (2E)- structure
|
Common Name | 2-Propen-1-one,1-(3-bromophenyl)-3-phenyl-, (2E)- | ||
|---|---|---|---|---|
| CAS Number | 22966-26-3 | Molecular Weight | 287.15100 | |
| Density | 1.393g/cm3 | Boiling Point | 403.4ºC at 760mmHg | |
| Molecular Formula | C15H11BrO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 83.2ºC | |
| Name | (E)-1-(3-bromophenyl)-3-phenylprop-2-en-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.393g/cm3 |
|---|---|
| Boiling Point | 403.4ºC at 760mmHg |
| Molecular Formula | C15H11BrO |
| Molecular Weight | 287.15100 |
| Flash Point | 83.2ºC |
| Exact Mass | 285.99900 |
| PSA | 17.07000 |
| LogP | 4.34520 |
| Vapour Pressure | 1.02E-06mmHg at 25°C |
| Index of Refraction | 1.646 |
| InChIKey | JSYOJZCSZYJDIZ-MDZDMXLPSA-N |
| SMILES | O=C(C=Cc1ccccc1)c1cccc(Br)c1 |
| HS Code | 2914700090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 3'-Brom-trans-chalkon |
| (E)-1-(3-bromophenyl)-3-phenyl-prop-2-en-1-one |
| 1-(3-bromophenyl)-3-phenylprop-2-en-1-one (12) |
| 3'-bromo-trans-chalcone |
| 3'-Bromchalcon |