Benzamide,N-(2,4-dichlorophenyl)-2-methyl- structure
|
Common Name | Benzamide,N-(2,4-dichlorophenyl)-2-methyl- | ||
|---|---|---|---|---|
| CAS Number | 22978-54-7 | Molecular Weight | 280.14900 | |
| Density | 1.343g/cm3 | Boiling Point | 326.7ºC at 760 mmHg | |
| Molecular Formula | C14H11Cl2NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 151.4ºC | |
| Name | N-(2,4-dichlorophenyl)-2-methylbenzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.343g/cm3 |
|---|---|
| Boiling Point | 326.7ºC at 760 mmHg |
| Molecular Formula | C14H11Cl2NO |
| Molecular Weight | 280.14900 |
| Flash Point | 151.4ºC |
| Exact Mass | 279.02200 |
| PSA | 29.10000 |
| LogP | 4.62710 |
| Vapour Pressure | 0.000212mmHg at 25°C |
| Index of Refraction | 1.643 |
| InChIKey | OLDRIRCHGCKATA-UHFFFAOYSA-N |
| SMILES | Cc1ccccc1C(=O)Nc1ccc(Cl)cc1Cl |
| HS Code | 2924299090 |
|---|
|
~%
Benzamide,N-(2,... CAS#:22978-54-7 |
| Literature: Hirwe; Jadhav; Sukhtankar Journal of the Indian Chemical Society, 1939 , vol. 16, p. 281,284 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2',4'-Dichlor-2-methylbenzanilid |