Acetic acid,2-(2,6-dichloro-4-nitrophenoxy)- structure
|
Common Name | Acetic acid,2-(2,6-dichloro-4-nitrophenoxy)- | ||
|---|---|---|---|---|
| CAS Number | 2300-67-6 | Molecular Weight | 266.03500 | |
| Density | 1.659g/cm3 | Boiling Point | 425.7ºC at 760mmHg | |
| Molecular Formula | C8H5Cl2NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 211.3ºC | |
| Name | 2-(2,6-dichloro-4-nitrophenoxy)acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.659g/cm3 |
|---|---|
| Boiling Point | 425.7ºC at 760mmHg |
| Molecular Formula | C8H5Cl2NO5 |
| Molecular Weight | 266.03500 |
| Flash Point | 211.3ºC |
| Exact Mass | 264.95400 |
| PSA | 92.35000 |
| LogP | 2.88820 |
| Vapour Pressure | 5.24E-08mmHg at 25°C |
| Index of Refraction | 1.608 |
| InChIKey | LEOSVWCQGFJFBG-UHFFFAOYSA-N |
| SMILES | O=C(O)COc1c(Cl)cc([N+](=O)[O-])cc1Cl |
|
~%
Acetic acid,2-(... CAS#:2300-67-6 |
| Literature: Faulkner,J.K.; Woodcock,D. Journal of the Chemical Society, 1965 , p. 1187 - 1191 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2,6-Dichlor-4-nitro-phenoxy-essigsaeure |