2,6-Dichloro-4-nitrophenol structure
|
Common Name | 2,6-Dichloro-4-nitrophenol | ||
|---|---|---|---|---|
| CAS Number | 618-80-4 | Molecular Weight | 207.999 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 285.2±40.0 °C at 760 mmHg | |
| Molecular Formula | C6H3Cl2NO3 | Melting Point | 123-126 °C (dec.) | |
| MSDS | N/A | Flash Point | 126.3±27.3 °C | |
| Name | 2,6-Dichloro-4-nitrophenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 285.2±40.0 °C at 760 mmHg |
| Melting Point | 123-126 °C (dec.) |
| Molecular Formula | C6H3Cl2NO3 |
| Molecular Weight | 207.999 |
| Flash Point | 126.3±27.3 °C |
| Exact Mass | 206.949005 |
| PSA | 66.05000 |
| LogP | 2.88 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.639 |
| InChIKey | PXSGFTWBZNPNIC-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc(Cl)c(O)c(Cl)c1 |
| Hazard Codes | Xn:Harmful; |
|---|---|
| Risk Phrases | R20/21/22;R36/37/38 |
| Safety Phrases | S26-S36-S36/37/39 |
| RIDADR | UN 2811 6.1/PG 1 |
| WGK Germany | 3 |
| Packaging Group | III |
| Hazard Class | 4.1 |
| HS Code | 2908999090 |
| Precursor 8 | |
|---|---|
| DownStream 9 | |
| HS Code | 2908999090 |
|---|---|
| Summary | 2908999090 halogenated, sulphonated, nitrated or nitrosated derivatives of phenols or phenol-alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 2,6-Dichlor-4-nitrobenzolol |
| EINECS 210-563-6 |
| Phenol,2,6-dichloro-4-nitro |
| 2.6-Dichlor-4-nitro-1-hydroxy-benzol |
| MFCD00014715 |
| 2,6-Dichloro-4-nitrophenol |
| 2-6-Dichloro-4-nitrophenol |
| 2,6-Dichlor-4-nitro-phenol |
| 4-Nitro-2,6-dichlorophenol |
| 2,5-DIBROMO-4-METHOXYPHENYLBORONIC ACID |
| Phenol, 2,6-dichloro-4-nitro- |