Benzene,1,2-dimethoxy-4-(2-nitro-1-buten-1-yl)- structure
|
Common Name | Benzene,1,2-dimethoxy-4-(2-nitro-1-buten-1-yl)- | ||
|---|---|---|---|---|
| CAS Number | 23023-08-7 | Molecular Weight | 237.25200 | |
| Density | 1.143g/cm3 | Boiling Point | 362.5ºC at 760mmHg | |
| Molecular Formula | C12H15NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 154ºC | |
| Name | 1,2-dimethoxy-4-(2-nitrobut-1-enyl)benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.143g/cm3 |
|---|---|
| Boiling Point | 362.5ºC at 760mmHg |
| Molecular Formula | C12H15NO4 |
| Molecular Weight | 237.25200 |
| Flash Point | 154ºC |
| Exact Mass | 237.10000 |
| PSA | 64.28000 |
| LogP | 3.25460 |
| Vapour Pressure | 4.03E-05mmHg at 25°C |
| Index of Refraction | 1.548 |
| InChIKey | NRBCNHBQBWHAJU-YFHOEESVSA-N |
| SMILES | CCC(=Cc1ccc(OC)c(OC)c1)[N+](=O)[O-] |
|
~%
Benzene,1,2-dim... CAS#:23023-08-7 |
| Literature: Ambros, Reinhard; Schneider, Martin R.; Angerer, Silvia von Journal of Medicinal Chemistry, 1990 , vol. 33, # 1 p. 153 - 160 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Benzene,1,2-dimethoxy-4-(1-methoxy-2-nitroethyl) |
| 12-Nitro-3.4.11-trimethoxy-1-aethyl-benzol |
| (dimethoxy-3,4 phenyl)-2 methoxy-2 nitro-1 ethane |
| 1,2-Dimethoxy-4-(2-nitro-but-1-enyl)-benzol |
| 1,2-dimethoxy-4-(1-methoxy-2-nitro-ethyl)-benzene |
| 2-Nitro-1-methoxy-1-(3.4-dimethoxy-phenyl)-aethan |
| 1,2-dimethoxy-4-(2-nitro-but-1-enyl)-benzene |
| 1,2-Dimethoxy-4-(1-methoxy-2-nitro-aethyl)-benzol |