Benzene,1,2-dimethoxy-4-(2-nitro-1-propen-1-yl)- structure
|
Common Name | Benzene,1,2-dimethoxy-4-(2-nitro-1-propen-1-yl)- | ||
|---|---|---|---|---|
| CAS Number | 122-47-4 | Molecular Weight | 223.22500 | |
| Density | 1.168g/cm3 | Boiling Point | 349.3ºC at 760mmHg | |
| Molecular Formula | C11H13NO4 | Melting Point | 68-71°C | |
| MSDS | N/A | Flash Point | 153.6ºC | |
| Name | 3,4-Dimethoxy-β-methyl-β-nitrostyrene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.168g/cm3 |
|---|---|
| Boiling Point | 349.3ºC at 760mmHg |
| Melting Point | 68-71°C |
| Molecular Formula | C11H13NO4 |
| Molecular Weight | 223.22500 |
| Flash Point | 153.6ºC |
| Exact Mass | 223.08400 |
| PSA | 64.28000 |
| LogP | 2.86450 |
| Vapour Pressure | 9.58E-05mmHg at 25°C |
| Index of Refraction | 1.555 |
| InChIKey | JGFBGRHDJMANRR-VURMDHGXSA-N |
| SMILES | COc1ccc(C=C(C)[N+](=O)[O-])cc1OC |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | 36/37/38 |
| Safety Phrases | S26-S36/37/39 |
| HS Code | 2909309090 |
|
~92%
Benzene,1,2-dim... CAS#:122-47-4 |
| Literature: ASTRAZENECA AB Patent: WO2005/61484 A1, 2005 ; Location in patent: Page/Page column 41 ; WO 2005/061484 A1 |
|
~%
Benzene,1,2-dim... CAS#:122-47-4 |
| Literature: Schmidt,E. et al. Chemische Berichte, 1922 , vol. 55, p. 1756 |
|
~%
Benzene,1,2-dim... CAS#:122-47-4 |
| Literature: Kauffmann Chemische Berichte, 1917 , vol. 50, p. 635 Chemische Berichte, 1919 , vol. 52, p. 1431 |
|
~%
Detail
|
| Literature: Schmidt,E. et al. Chemische Berichte, 1922 , vol. 55, p. 1756 |
| Precursor 7 | |
|---|---|
| DownStream 4 | |
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| MFCD00024815 |
| EINECS 204-547-8 |
| 1-(3,4-DIMETHOXYPHENYL)-2-NITRO-1-PROPENE |
| 3,4-DIMETHOXY-β-METHYL-β-NITROSTYRENE |