Tri(3-fluorophenyl)phosphine structure
|
Common Name | Tri(3-fluorophenyl)phosphine | ||
|---|---|---|---|---|
| CAS Number | 23039-94-3 | Molecular Weight | 316.25700 | |
| Density | N/A | Boiling Point | 371.1ºC at 760mmHg | |
| Molecular Formula | C18H12F3P | Melting Point | 62 °C | |
| MSDS | N/A | Flash Point | 178.2ºC | |
Use of Tri(3-fluorophenyl)phosphine |
| Name | tris(3-fluorophenyl)phosphane |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 371.1ºC at 760mmHg |
|---|---|
| Melting Point | 62 °C |
| Molecular Formula | C18H12F3P |
| Molecular Weight | 316.25700 |
| Flash Point | 178.2ºC |
| Exact Mass | 316.06300 |
| PSA | 13.59000 |
| LogP | 3.86210 |
| Vapour Pressure | 2.26E-05mmHg at 25°C |
| InChIKey | CUTRINLXFPIWQB-UHFFFAOYSA-N |
| SMILES | Fc1cccc(P(c2cccc(F)c2)c2cccc(F)c2)c1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S37/39 |
| HS Code | 2903999090 |
|
~42%
Tri(3-fluorophe... CAS#:23039-94-3 |
| Literature: Goto, Akihiro; Otake, Kazuki; Kubo, Ozora; Sawama, Yoshinari; Maegawa, Tomohiro; Fujioka, Hiromichi Chemistry - A European Journal, 2012 , vol. 18, # 36 p. 11423 - 11432 |
| HS Code | 2903999090 |
|---|---|
| Summary | 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| MFCD00015722 |