(S,R,S)-AHPC-C7-amine
Modify Date: 2025-09-11 13:25:20
(S,R,S)-AHPC-C7-amine structure
|
Common Name | (S,R,S)-AHPC-C7-amine | ||
|---|---|---|---|---|
| CAS Number | 2306389-04-6 | Molecular Weight | 571.77 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C30H45N5O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of (S,R,S)-AHPC-C7-amine(S,R,S)-AHPC-C7-amine (VH032-C7-amine) is a synthesized E3 ligase ligand-linker conjugate that incorporates the VH032 based VHL ligand and a linker used for estrogen-related receptor α (ERRα) PROTAC degrader[1]. |
| Name | (S,R,S)-AHPC-C7-amine |
|---|
| Description | (S,R,S)-AHPC-C7-amine (VH032-C7-amine) is a synthesized E3 ligase ligand-linker conjugate that incorporates the VH032 based VHL ligand and a linker used for estrogen-related receptor α (ERRα) PROTAC degrader[1]. |
|---|---|
| Related Catalog | |
| Target |
VHL |
| References |
| Molecular Formula | C30H45N5O4S |
|---|---|
| Molecular Weight | 571.77 |
| InChIKey | KHXMEYUTLVQWBB-ONBPZOJHSA-N |
| SMILES | Cc1ncsc1-c1ccc(CNC(=O)C2CC(O)CN2C(=O)C(NC(=O)CCCCCCCN)C(C)(C)C)cc1 |