10-(3-dimethylaminopropyl)acridin-9-one structure
|
Common Name | 10-(3-dimethylaminopropyl)acridin-9-one | ||
|---|---|---|---|---|
| CAS Number | 2307-88-2 | Molecular Weight | 280.36400 | |
| Density | 1.13g/cm3 | Boiling Point | 427.8ºC at 760mmHg | |
| Molecular Formula | C18H20N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 182.7ºC | |
| Name | 10-[3-(dimethylamino)propyl]acridin-9-one |
|---|
| Density | 1.13g/cm3 |
|---|---|
| Boiling Point | 427.8ºC at 760mmHg |
| Molecular Formula | C18H20N2O |
| Molecular Weight | 280.36400 |
| Flash Point | 182.7ºC |
| Exact Mass | 280.15800 |
| PSA | 25.24000 |
| LogP | 3.10640 |
| Vapour Pressure | 1.59E-07mmHg at 25°C |
| Index of Refraction | 1.596 |
| InChIKey | UFLIFHIYLXSQEG-UHFFFAOYSA-N |
| SMILES | CN(C)CCCn1c2ccccc2c(=O)c2ccccc21 |
| HS Code | 2933990090 |
|---|
|
~%
10-(3-dimethyla... CAS#:2307-88-2 |
| Literature: Bahr, Nicolaus; Tierney, Emily; Reymond, Jean-Louis Tetrahedron Letters, 1997 , vol. 38, # 9 p. 1489 - 1492 |
|
~%
10-(3-dimethyla... CAS#:2307-88-2 |
| Literature: Schmolka; Zimmer Synthesis, 1984 , vol. NO. 1, p. 29 - 31 |
|
~%
10-(3-dimethyla... CAS#:2307-88-2 |
| Literature: Bahr, Nicolaus; Tierney, Emily; Reymond, Jean-Louis Tetrahedron Letters, 1997 , vol. 38, # 9 p. 1489 - 1492 |
| Precursor 4 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |