Carbamic acid,N-(2-nitrophenyl)-, phenylmethyl ester
Modify Date: 2025-10-10 17:08:27
Carbamic acid,N-(2-nitrophenyl)-, phenylmethyl ester structure
|
Common Name | Carbamic acid,N-(2-nitrophenyl)-, phenylmethyl ester | ||
|---|---|---|---|---|
| CAS Number | 23091-35-2 | Molecular Weight | 272.25600 | |
| Density | 1.351g/cm3 | Boiling Point | 392.1ºC at 760 mmHg | |
| Molecular Formula | C14H12N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 191ºC | |
| Name | benzyl N-(2-nitrophenyl)carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.351g/cm3 |
|---|---|
| Boiling Point | 392.1ºC at 760 mmHg |
| Molecular Formula | C14H12N2O4 |
| Molecular Weight | 272.25600 |
| Flash Point | 191ºC |
| Exact Mass | 272.08000 |
| PSA | 84.15000 |
| LogP | 3.93970 |
| Vapour Pressure | 2.34E-06mmHg at 25°C |
| Index of Refraction | 1.648 |
| InChIKey | LGFRPSBWXQHKGN-UHFFFAOYSA-N |
| SMILES | O=C(Nc1ccccc1[N+](=O)[O-])OCc1ccccc1 |
| HS Code | 2924299090 |
|---|
|
~92%
Carbamic acid,N... CAS#:23091-35-2 |
| Literature: Sumitomo Chemical Company, Limited Patent: EP1172356 A1, 2002 ; Location in patent: Page 9 ; |
|
~84%
Carbamic acid,N... CAS#:23091-35-2 |
| Literature: Merisor, Elena; Conrad, Juergen; Mika, Sabine; Beifuss, Uwe Synlett, 2007 , # 13 p. 2033 - 2036 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-benzyloxycarbonyl-2-nitroaniline |
| Carbamic acid,N-(2-nitrophenyl)-,phenylmethyl ester |
| (2-Nitro-phenyl)-carbamidsaeure-benzylester |
| Benzyl-o-nitrophenyl-carbamat |
| Benzyl-N-(o-nitro-phenyl)-carbamat |
| (2-nitro-phenyl)-carbamic acid benzyl ester |