2-Nitrophenyl isocyanate structure
|
Common Name | 2-Nitrophenyl isocyanate | ||
|---|---|---|---|---|
| CAS Number | 3320-86-3 | Molecular Weight | 164.118 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 256.2±0.0 °C at 760 mmHg | |
| Molecular Formula | C7H4N2O3 | Melting Point | 40-41 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 115.1±22.6 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 1-isocyanato-2-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 256.2±0.0 °C at 760 mmHg |
| Melting Point | 40-41 °C(lit.) |
| Molecular Formula | C7H4N2O3 |
| Molecular Weight | 164.118 |
| Flash Point | 115.1±22.6 °C |
| Exact Mass | 164.022186 |
| PSA | 75.25000 |
| LogP | 3.12 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.589 |
| InChIKey | JRVZITODZAQRQM-UHFFFAOYSA-N |
| SMILES | O=C=Nc1ccccc1[N+](=O)[O-] |
| Storage condition | Refrigerator (+4°C) |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302 + H312 + H332-H315-H319-H335 |
| Precautionary Statements | P261-P280-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn: Harmful; |
| Risk Phrases | R20/21/22 |
| Safety Phrases | S26-S27-S36/37/39 |
| RIDADR | 2206 |
| WGK Germany | 3 |
| Packaging Group | III |
| Hazard Class | 6.1(b) |
| HS Code | 2929109000 |
| HS Code | 2929109000 |
|---|---|
| Summary | 2929109000. other isocyanates. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Intramolecular reaction between nitro and carbodi-imide groups; a new synthesis of 2-arylbenzotriazoles. Houghton PG, et al.
J. Chem. Soc. Perkin Trans. I , 1471-1479, (1985)
|
| 2-Nitrophenyl isocyanate |
| 2-nitrobenzenisocyanate |
| Benzene, 1-isocyanato-2-nitro- |
| O-NITROPHENYL ISOCYANATE |
| Benzene,1-isocyanato-2-nitro |
| Isocyanic acid,o-nitrophenyl ester |
| EINECS 222-024-2 |
| MFCD00007092 |
| ortho-nitrophenylisocyanate |
| 1-Isocyanato-2-nitrobenzene |