5-Bromo-2-methoxybenzenesulfonyl chloride structure
|
Common Name | 5-Bromo-2-methoxybenzenesulfonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 23095-05-8 | Molecular Weight | 285.543 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 362.3±32.0 °C at 760 mmHg | |
| Molecular Formula | C7H6BrClO3S | Melting Point | 115-118 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 172.9±25.1 °C | |
| Symbol |
GHS05 |
Signal Word | Danger | |
| Name | 5-bromo-2-methoxybenzenesulfonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 362.3±32.0 °C at 760 mmHg |
| Melting Point | 115-118 °C(lit.) |
| Molecular Formula | C7H6BrClO3S |
| Molecular Weight | 285.543 |
| Flash Point | 172.9±25.1 °C |
| Exact Mass | 283.890961 |
| PSA | 51.75000 |
| LogP | 3.30 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.569 |
| InChIKey | IXSBNNRUQYYMRM-UHFFFAOYSA-N |
| SMILES | COc1ccc(Br)cc1S(=O)(=O)Cl |
| Storage condition | 2-8°C |
| Symbol |
GHS05 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H314 |
| Precautionary Statements | P280-P305 + P351 + P338-P310 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
| Hazard Codes | C: Corrosive; |
| Risk Phrases | R34 |
| Safety Phrases | S26-S36/37/39-S45 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| Packaging Group | II |
| Hazard Class | 8 |
| HS Code | 2909309090 |
|
~%
5-Bromo-2-metho... CAS#:23095-05-8 |
| Literature: Journal of the Chemical Society [Section] C: Organic, , p. 1341 - 1345 |
|
~%
5-Bromo-2-metho... CAS#:23095-05-8 |
| Literature: Journal of Medicinal Chemistry, , vol. 55, # 11 p. 5467 - 5482 |
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 5-bromo-2-methoxyphenylsulfonyl chloride |
| 5-bromo-2-methoxyphenyl-1-sulfonyl chloride |
| 5-bromo-2-methoxy-benzenesulfonylchloride |
| Benzenesulfonyl chloride, 5-bromo-2-methoxy- |
| MFCD00051768 |
| 5-Bromo-2-methoxybenzenesulfonyl chloride |
| 5-bromo-2-methoxybenzene-1-sulfonyl chloride |