(Z)-Oxamyl structure
|
Common Name | (Z)-Oxamyl | ||
|---|---|---|---|---|
| CAS Number | 23135-22-0 | Molecular Weight | 219.261 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C7H13N3O3S | Melting Point | 100°C | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS06, GHS09 |
Signal Word | Danger | |
| Name | oxamyl |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Melting Point | 100°C |
| Molecular Formula | C7H13N3O3S |
| Molecular Weight | 219.261 |
| Exact Mass | 219.067764 |
| PSA | 96.30000 |
| LogP | -0.47 |
| Index of Refraction | 1.532 |
| InChIKey | KZAUOCCYDRDERY-UITAMQMPSA-N |
| SMILES | CNC(=O)ON=C(SC)C(=O)N(C)C |
| Water Solubility | 28 g/100 mL |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS06, GHS09 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H300-H312-H330-H411 |
| Precautionary Statements | P260-P264-P273-P280-P284-P301 + P310 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
| Hazard Codes | T+:Verytoxic;N:Dangerous for the environment; |
| Risk Phrases | R21;R26/28;R51/53 |
| Safety Phrases | S36/37-S45-S61 |
| RIDADR | UN 2811 |
| RTECS | RP2300000 |
| Packaging Group | I |
| Hazard Class | 6.1(a) |
| HS Code | 2930909052 |
| Precursor 0 | |
|---|---|
| DownStream 3 | |
| HS Code | 2930909052 |
|---|---|
| Summary | 2930909052 (e)-2-methyl-2-(methylsulfonyl)propanal o-methylcarbamoyl oxime。supervision conditions:s(import or export registration certificate for pesticides)。VAT:17.0%。tax rebate rate:0.0%。MFN tarrif:6.5%。general tariff:30.0% |
|
Effects of exposure to oxamyl, carbofuran, dichlorvos, and lindane on acetylcholinesterase activity in the gills of the Pacific oyster Crassostrea gigas.
Environ. Toxicol. 25(4) , 327-32, (2010) Acetylcholinesterase (AChE) activity has been used to test the exposure of mollusk bivalves to pesticides and other pollutants. The Pacific oyster Crassostrea gigas is a species with a worldwide distr... |
|
|
Relative inhibition of rat plasma and erythrocyte cholinesterases by pesticide combinations.
Vet. Hum. Toxicol. 33(2) , 166-8, (1991) A selected combination of carbamate pesticides (carbofuran, oxamyl and propoxur were examined for cholinesterase (ChE) inhibition. The enzyme source was rat plasma and erythrocytes. Enzyme activity wa... |
|
|
Differential toxicities of organophosphate and carbamate insecticides in the nestling European starling (Sturnus vulgaris).
Arch. Environ. Contam. Toxicol. 39(2) , 233-42, (2000) The concept of B-esterase buffering against anti-cholinesterase (ChE) insecticide toxicity has been extensively researched in mammalian species. Presumably due to relatively low levels of anti-ChE det... |
| thioxamyl |
| Ethanimidothioic acid, 2-(dimethylamino)-N-(((methylamino)carbonyl)oxy)-2-oxo-, methyl ester |
| Vydate-G |
| methyl (1Z)-2-(dimethylamino)-N-(methylcarbamoyloxy)-2-oxoethanimidothioate |
| methyl (1Z)-2-(dimethylamino)-N-{[(methylamino)carbonyl]oxy}-2-oxoethanimidothioate |
| Methyl 2-(dimethylamino)-N-(((methylamino)carbonyl)oxy)-2-oxoethanimidothioate |
| Oxamil |
| EINECS 245-445-3 |
| Methyl (1Z)-2-(dimethylamino)-N-[(methylcarbamoyl)oxy]-2-oxoethanimidothioate |
| (EZ)-N,N-dimethyl-2-methylcarbamoyloxyimino-2-(methylthio)acetamide |
| methyl (1Ξ)-2-(dimethylamino)-N-[(methylcarbamoyl)oxy]-2-oxoethanimidothioate |
| methyl 2-(dimethylamino)-N-[[(methylamino)carbonyl]oxy]-2-oxoethanimidothioate |
| Oxamyl PESTANAL(R),analytical standard |
| MFCD00055334 |
| Vydate K |
| Vydate L |
| N,N-Dimethyl-2-methylcarbamoyloxyimino-2-(methylthio)acetamide |
| VYDATE |
| Ethanimidothioic acid, 2-(dimethylamino)-N-[[(methylamino)carbonyl]oxy]-2-oxo-, methyl ester, (1Z)- |
| Oxamyl |