Benzoic acid,2-[[(3-methoxyphenyl)methyl][(4-methylphenyl)sulfonyl]amino]- structure
|
Common Name | Benzoic acid,2-[[(3-methoxyphenyl)methyl][(4-methylphenyl)sulfonyl]amino]- | ||
|---|---|---|---|---|
| CAS Number | 23145-77-9 | Molecular Weight | 411.47100 | |
| Density | 1.324g/cm3 | Boiling Point | 606.9ºC at 760mmHg | |
| Molecular Formula | C22H21NO5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 320.8ºC | |
| Name | 2-[(3-methoxyphenyl)methyl-(4-methylphenyl)sulfonylamino]benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.324g/cm3 |
|---|---|
| Boiling Point | 606.9ºC at 760mmHg |
| Molecular Formula | C22H21NO5S |
| Molecular Weight | 411.47100 |
| Flash Point | 320.8ºC |
| Exact Mass | 411.11400 |
| PSA | 92.29000 |
| LogP | 5.17810 |
| Vapour Pressure | 1.4E-15mmHg at 25°C |
| Index of Refraction | 1.631 |
| InChIKey | SHYSAABJUCFNCW-UHFFFAOYSA-N |
| SMILES | COc1cccc(CN(c2ccccc2C(=O)O)S(=O)(=O)c2ccc(C)cc2)c1 |
|
~%
Benzoic acid,2-... CAS#:23145-77-9 |
|
Literature: MacDonald,I.; Proctor,G.R. Journal of the Chemical Society [Section] C: Organic, 1969 , vol. |
|
~%
Benzoic acid,2-... CAS#:23145-77-9 |
|
Literature: MacDonald,I.; Proctor,G.R. Journal of the Chemical Society [Section] C: Organic, 1969 , vol. |
|
~%
Benzoic acid,2-... CAS#:23145-77-9 |
|
Literature: MacDonald,I.; Proctor,G.R. Journal of the Chemical Society [Section] C: Organic, 1969 , vol. |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 2-{(3-methoxybenzyl)[(4-methylphenyl)sulfonyl]amino}benzoic acid |
| N-(3-Methoxy-benzyl)-N-p-toluolsulfonyl-anthranilsaeure |