Carbanilic acid,o-nitro-, p-methoxybenzyl ester (8CI) structure
|
Common Name | Carbanilic acid,o-nitro-, p-methoxybenzyl ester (8CI) | ||
|---|---|---|---|---|
| CAS Number | 23185-21-9 | Molecular Weight | 302.28200 | |
| Density | 1.34g/cm3 | Boiling Point | 428.7ºC at 760mmHg | |
| Molecular Formula | C15H14N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 213.1ºC | |
| Name | (4-methoxyphenyl)methyl N-(2-nitrophenyl)carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.34g/cm3 |
|---|---|
| Boiling Point | 428.7ºC at 760mmHg |
| Molecular Formula | C15H14N2O5 |
| Molecular Weight | 302.28200 |
| Flash Point | 213.1ºC |
| Exact Mass | 302.09000 |
| PSA | 93.38000 |
| LogP | 3.94830 |
| Vapour Pressure | 1.48E-07mmHg at 25°C |
| Index of Refraction | 1.627 |
| InChIKey | NTRUIJMHUAMRRH-UHFFFAOYSA-N |
| SMILES | COc1ccc(COC(=O)Nc2ccccc2[N+](=O)[O-])cc1 |
|
~%
Carbanilic acid... CAS#:23185-21-9 |
| Literature: Prokipcak,J.M. et al. Canadian Journal of Chemistry, 1969 , vol. 47, # 13 p. 2482 - 2484 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| p-Methoxy-benzyl-N-(o-nitro-phenyl)-carbamat |