Carbanilic acid,o-nitro-, p-nitrobenzyl ester (8CI) structure
|
Common Name | Carbanilic acid,o-nitro-, p-nitrobenzyl ester (8CI) | ||
|---|---|---|---|---|
| CAS Number | 23185-22-0 | Molecular Weight | 317.25400 | |
| Density | 1.487g/cm3 | Boiling Point | 476.5ºC at 760mmHg | |
| Molecular Formula | C14H11N3O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 242ºC | |
| Name | (4-nitrophenyl)methyl N-(2-nitrophenyl)carbamate |
|---|
| Density | 1.487g/cm3 |
|---|---|
| Boiling Point | 476.5ºC at 760mmHg |
| Molecular Formula | C14H11N3O6 |
| Molecular Weight | 317.25400 |
| Flash Point | 242ºC |
| Exact Mass | 317.06500 |
| PSA | 129.97000 |
| LogP | 4.37110 |
| Vapour Pressure | 3.04E-09mmHg at 25°C |
| Index of Refraction | 1.671 |
| InChIKey | WSPQYIQSJIGXTG-UHFFFAOYSA-N |
| SMILES | O=C(Nc1ccccc1[N+](=O)[O-])OCc1ccc([N+](=O)[O-])cc1 |
|
~%
Carbanilic acid... CAS#:23185-22-0 |
| Literature: Prokipcak,J.M. et al. Canadian Journal of Chemistry, 1969 , vol. 47, # 13 p. 2482 - 2484 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |