2,4-Imidazolidinedione,5,5-bis(4-chlorophenyl)- structure
|
Common Name | 2,4-Imidazolidinedione,5,5-bis(4-chlorophenyl)- | ||
|---|---|---|---|---|
| CAS Number | 23186-92-7 | Molecular Weight | 321.15800 | |
| Density | 1.43g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C15H10Cl2N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5,5-bis(4-chlorophenyl)imidazolidine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.43g/cm3 |
|---|---|
| Molecular Formula | C15H10Cl2N2O2 |
| Molecular Weight | 321.15800 |
| Exact Mass | 320.01200 |
| PSA | 58.20000 |
| LogP | 3.73400 |
| Index of Refraction | 1.625 |
| InChIKey | QUIIKRQNYWCNAM-UHFFFAOYSA-N |
| SMILES | O=C1NC(=O)C(c2ccc(Cl)cc2)(c2ccc(Cl)cc2)N1 |
|
~95%
2,4-Imidazolidi... CAS#:23186-92-7 |
| Literature: Safari, Javad; Moshtael Arani, Naimeh; Anousheh Isfahani, Ramezan Chinese Journal of Chemistry, 2010 , vol. 28, # 2 p. 255 - 258 |
|
~96%
2,4-Imidazolidi... CAS#:23186-92-7 |
| Literature: Xiao; Timberlake Journal of Heterocyclic Chemistry, 2000 , vol. 37, # 4 p. 773 - 777 |
|
~66%
2,4-Imidazolidi... CAS#:23186-92-7 |
| Literature: Klumpp, Douglas A.; Yeung, Ka Yeun; Prakash, G. K. Surya; Olah, George A. Synlett, 1998 , # 8 p. 918 - 920 |
| 5,5'-Bis-(4-chlor-phenyl)-1,1'-hexandiyl-bis-biguanid,Dihydrochlorid |
| chlorhexidine dihydrochloride |
| 5,5'-bis-(4-chloro-phenyl)-1,1'-hexanediyl-bis-biguanide,dihydrochloride |
| 5,5-bis-(4-chloro-phenyl)-imidazolidine-2,4-dione |
| Arlacide H |
| 5,5-Bis-(4-chlor-phenyl)-imidazolidin-2,4-dion |
| 5,5-di(4-chlorophenyl)hydantoin |
| Chlorhexidinium dichloride |
| 5,5-bis(4-chlorophenyl)hydantoin |
| CHLORHEXIDINE HYDROCHLORIDE |
| Chlorhexidine HCl |
| dihydrochloride of chlorhexidine |
| N,N''-bis(4-chlorophenyl)-3,12-diimino-2,4,11,13-tetraazatetradecanediimidamide,dihydrochloride |