2,4-Imidazolidinedione,5,5-bis(1-methylethyl)- structure
|
Common Name | 2,4-Imidazolidinedione,5,5-bis(1-methylethyl)- | ||
|---|---|---|---|---|
| CAS Number | 52532-01-1 | Molecular Weight | 184.23600 | |
| Density | 1.044g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C9H16N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5,5-di(propan-2-yl)imidazolidine-2,4-dione |
|---|
| Density | 1.044g/cm3 |
|---|---|
| Molecular Formula | C9H16N2O2 |
| Molecular Weight | 184.23600 |
| Exact Mass | 184.12100 |
| PSA | 58.20000 |
| LogP | 1.53420 |
| Index of Refraction | 1.461 |
| InChIKey | KTYKGWCUSJAWEU-UHFFFAOYSA-N |
| SMILES | CC(C)C1(C(C)C)NC(=O)NC1=O |
| HS Code | 2933990090 |
|---|
|
~%
2,4-Imidazolidi... CAS#:52532-01-1 |
| Literature: Henze; Speer Journal of the American Chemical Society, 1942 , vol. 64, p. 522 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |