2',3',5'-TRI-O-ACETYL-8-FLUORO ADENOSINE structure
|
Common Name | 2',3',5'-TRI-O-ACETYL-8-FLUORO ADENOSINE | ||
|---|---|---|---|---|
| CAS Number | 23205-66-5 | Molecular Weight | 411.34200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H18FN5O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [(2R,3R,4R,5R)-3,4-diacetyloxy-5-(6-amino-8-fluoropurin-9-yl)oxolan-2-yl]methyl acetate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H18FN5O7 |
|---|---|
| Molecular Weight | 411.34200 |
| Exact Mass | 411.11900 |
| PSA | 157.75000 |
| LogP | 0.45270 |
| InChIKey | YRTXFEDFTSISLW-SDBHATRESA-N |
| SMILES | CC(=O)OCC1OC(n2c(F)nc3c(N)ncnc32)C(OC(C)=O)C1OC(C)=O |
|
~25%
2',3',5'-TRI-O-... CAS#:23205-66-5 |
| Literature: Barrio, Jorge R.; Namavari, Mohammad; Phelps, Michael E.; Satyamurthy, Nagichettiar Journal of the American Chemical Society, 1996 , vol. 118, # 43 p. 10408 - 10411 |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
| 2',3',5'-Tri-O-acetyl-8-fluoroadenosine |
| 2A'A inverted exclamation markA'A,3A'A inverted exclamation markA'A,5A'A inverted exclamation markA'A-TRI-O-ACETYL-8-FLUORO ADENOSINE |
| Adenosine,8-fluoro-,2',3',5'-triacetate |
| O2',O3',O5'5'-triacetyl-8-fluoro-adenosine |